C29H41NO5 — CID 23862539
(3aS,4R,7aR)-5-[(E,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-2,6-dipropyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23862539) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(E,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-2,6-dipropyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(E,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-2,6-dipropyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23862539 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | (3aS,4R,7aR)-5-[(E,1R)-1-hydroxy-5-(4-hydroxy-3,5-dimethylphenyl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-2,6-dipropyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCCC1=C([C@H](O)CC/C(C)=C/c2cc(C)c(O)c(C)c2)[C@H](CO)[C@@H]2C(=O)N(CCC)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C29H41NO5/c1-6-8-21-15-22-26(29(35)30(11-7-2)28(22)34)23(16-31)25(21)24(32)10-9-17(3)12-20-13-18(4)27(33)19(5)14-20/h12-14,22-24,26,31-33H,6-11,15-16H2,1-5H3/b17-12+/t22-,23+,24-,26-/m1/s1 |
| InChIKey | NORLFQDLAXJUCS-TWLVKPQVSA-N |
| XLogP | 4.67 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|