C34H40FNO5 — CID 23946384
(3aS,4R,7aR)-2-cyclohexyl-6-ethyl-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23946384) has the molecular formula C34H40FNO5 and a molecular weight of 561.69 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-cyclohexyl-6-ethyl-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-cyclohexyl-6-ethyl-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23946384 |
| Molecular Formula | C34H40FNO5 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | (3aS,4R,7aR)-2-cyclohexyl-6-ethyl-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-phenylpent-4-enyl]-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCC1=C([C@H](O)CC/C(=C/c2ccc(O)c(F)c2)c2ccccc2)[C@H](CO)[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C34H40FNO5/c1-2-22-19-26-32(34(41)36(33(26)40)25-11-7-4-8-12-25)27(20-37)31(22)30(39)16-14-24(23-9-5-3-6-10-23)17-21-13-15-29(38)28(35)18-21/h3,5-6,9-10,13,15,17-18,25-27,30,32,37-39H,2,4,7-8,11-12,14,16,19-20H2,1H3/b24-17-/t26-,27+,30-,32-/m1/s1 |
| InChIKey | KUWDIQLJZNHUST-KQCLPKFGSA-N |
| XLogP | 5.87 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|