C35H42BrNO6 — CID 23946403
(3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-2-cyclohexyl-4-(hydroxymethyl)-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23946403) has the molecular formula C35H42BrNO6 and a molecular weight of 652.63 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-2-cyclohexyl-4-(hydroxymethyl)-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-2-cyclohexyl-4-(hydroxymethyl)-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23946403 |
| Molecular Formula | C35H42BrNO6 |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 651.22 |
| IUPAC Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(5-bromo-2-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-2-cyclohexyl-4-(hydroxymethyl)-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC/C(=C\c1cc(Br)ccc1O)CC[C@@H](O)C1=C(COc2ccccc2)C[C@H]2C(=O)N(C3CCCCC3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C35H42BrNO6/c1-2-22(17-23-18-25(36)14-16-30(23)39)13-15-31(40)32-24(21-43-27-11-7-4-8-12-27)19-28-33(29(32)20-38)35(42)37(34(28)41)26-9-5-3-6-10-26/h4,7-8,11-12,14,16-18,26,28-29,31,33,38-40H,2-3,5-6,9-10,13,15,19-21H2,1H3/b22-17+/t28-,29+,31-,33-/m1/s1 |
| InChIKey | LHRWRKXFWGPTAG-IPLZZHLMSA-N |
| XLogP | 6.41 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|