C33H41NO7 — CID 23918331
(3aS,4R,7aR)-2-cyclohexyl-5-[(E,1R)-1-hydroxy-5-[5-(hydroxymethyl)furan-2-yl]-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23918331) has the molecular formula C33H41NO7 and a molecular weight of 563.69 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-cyclohexyl-5-[(E,1R)-1-hydroxy-5-[5-(hydroxymethyl)furan-2-yl]-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(E,1R)-1-hydroxy-5-[5-(hydroxymethyl)furan-2-yl]-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23918331 |
| Molecular Formula | C33H41NO7 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(E,1R)-1-hydroxy-5-[5-(hydroxymethyl)furan-2-yl]-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C/C(=C\c1ccc(CO)o1)CC[C@@H](O)C1=C(COc2ccccc2)C[C@H]2C(=O)N(C3CCCCC3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C33H41NO7/c1-21(16-25-13-14-26(18-35)41-25)12-15-29(37)30-22(20-40-24-10-6-3-7-11-24)17-27-31(28(30)19-36)33(39)34(32(27)38)23-8-4-2-5-9-23/h3,6-7,10-11,13-14,16,23,27-29,31,35-37H,2,4-5,8-9,12,15,17-20H2,1H3/b21-16+/t27-,28+,29-,31-/m1/s1 |
| InChIKey | LZIUEZBWBKMLSU-XPYNYZPVSA-N |
| XLogP | 4.64 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|