C25H33NO9 — CID 23834164
methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[[5-(hydroxymethyl)furan-2-yl]methylidene]hexyl]-4-(hydroxymethyl)-6-(methoxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 23834164) has the molecular formula C25H33NO9 and a molecular weight of 491.54 g/mol. Its IUPAC name is methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[[5-(hydroxymethyl)furan-2-yl]methylidene]hexyl]-4-(hydroxymethyl)-6-(methoxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[[5-(hydroxymethyl)furan-2-yl]methylidene]hexyl]-4-(hydroxymethyl)-6-(methoxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 23834164 |
| Molecular Formula | C25H33NO9 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[[5-(hydroxymethyl)furan-2-yl]methylidene]hexyl]-4-(hydroxymethyl)-6-(methoxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | CC/C(=C\c1ccc(CO)o1)CC[C@@H](O)C1=C(COC)C[C@H]2C(=O)N(C(=O)OC)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C25H33NO9/c1-4-14(9-16-6-7-17(11-27)35-16)5-8-20(29)21-15(13-33-2)10-18-22(19(21)12-28)24(31)26(23(18)30)25(32)34-3/h6-7,9,18-20,22,27-29H,4-5,8,10-13H2,1-3H3/b14-9+/t18-,19+,20-,22-/m1/s1 |
| InChIKey | CFBYRHYPIRVYLF-BGZOUZSUSA-N |
| XLogP | 2.03 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|