C36H39NO8 — CID 23805556
methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4-(hydroxymethyl)-1,3-dioxo-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-2-carboxylate (PubChem CID 23805556) has the molecular formula C36H39NO8 and a molecular weight of 613.71 g/mol. Its IUPAC name is methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4-(hydroxymethyl)-1,3-dioxo-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-2-carboxylate.
| Compound Name | methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4-(hydroxymethyl)-1,3-dioxo-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 23805556 |
| Molecular Formula | C36H39NO8 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | methyl (3aS,4R,7aR)-5-[(1R,4E)-1-hydroxy-4-[(4-hydroxynaphthalen-1-yl)methylidene]heptyl]-4-(hydroxymethyl)-1,3-dioxo-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-2-carboxylate |
| SMILES | CCC/C(=C\c1ccc(O)c2ccccc12)CC[C@@H](O)C1=C(COc2ccccc2)C[C@H]2C(=O)N(C(=O)OC)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C36H39NO8/c1-3-9-22(18-23-15-17-30(39)27-13-8-7-12-26(23)27)14-16-31(40)32-24(21-45-25-10-5-4-6-11-25)19-28-33(29(32)20-38)35(42)37(34(28)41)36(43)44-2/h4-8,10-13,15,17-18,28-29,31,33,38-40H,3,9,14,16,19-21H2,1-2H3/b22-18+/t28-,29+,31-,33-/m1/s1 |
| InChIKey | APADCWQSNOWBQP-GCSCWRQASA-N |
| XLogP | 5.63 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|