C38H37NO6 — CID 23805564
(3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-2-methyl-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23805564) has the molecular formula C38H37NO6 and a molecular weight of 603.72 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-2-methyl-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-2-methyl-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23805564 |
| Molecular Formula | C38H37NO6 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-phenylpent-4-enyl]-4-(hydroxymethyl)-2-methyl-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CN1C(=O)[C@@H]2[C@@H](CC(COc3ccccc3)=C([C@H](O)CC/C(=C/c3ccc(O)c4ccccc34)c3ccccc3)[C@@H]2CO)C1=O |
| InChI | InChI=1S/C38H37NO6/c1-39-37(43)31-21-27(23-45-28-12-6-3-7-13-28)35(32(22-40)36(31)38(39)44)34(42)19-16-25(24-10-4-2-5-11-24)20-26-17-18-33(41)30-15-9-8-14-29(26)30/h2-15,17-18,20,31-32,34,36,40-42H,16,19,21-23H2,1H3/b25-20-/t31-,32+,34-,36-/m1/s1 |
| InChIKey | SGCMUWAHFKZDMT-DANUTSAKSA-N |
| XLogP | 5.85 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|