C30H34FNO6 — CID 23747182
(3aS,4R,7aR)-5-[(1R,4E)-4-[(3-fluoro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-2-methyl-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23747182) has the molecular formula C30H34FNO6 and a molecular weight of 523.60 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(1R,4E)-4-[(3-fluoro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-2-methyl-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(3-fluoro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-2-methyl-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23747182 |
| Molecular Formula | C30H34FNO6 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (3aS,4R,7aR)-5-[(1R,4E)-4-[(3-fluoro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4-(hydroxymethyl)-2-methyl-6-(phenoxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC/C(=C\c1ccc(O)c(F)c1)CC[C@@H](O)C1=C(COc2ccccc2)C[C@H]2C(=O)N(C)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C30H34FNO6/c1-3-18(13-19-10-11-25(34)24(31)14-19)9-12-26(35)27-20(17-38-21-7-5-4-6-8-21)15-22-28(23(27)16-33)30(37)32(2)29(22)36/h4-8,10-11,13-14,22-23,26,28,33-35H,3,9,12,15-17H2,1-2H3/b18-13+/t22-,23+,26-,28-/m1/s1 |
| InChIKey | QQPALQIZBBPEAE-BNZZEBJASA-N |
| XLogP | 4.08 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|