C29H33BFNO8 — CID 23918426
[3-[(3aS,4R,7aR)-5-[(1R,4E)-4-[(3-fluoro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid (PubChem CID 23918426) has the molecular formula C29H33BFNO8 and a molecular weight of 553.39 g/mol. Its IUPAC name is [3-[(3aS,4R,7aR)-5-[(1R,4E)-4-[(3-fluoro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,4R,7aR)-5-[(1R,4E)-4-[(3-fluoro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 23918426 |
| Molecular Formula | C29H33BFNO8 |
| Molecular Weight | 553.39 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | [3-[(3aS,4R,7aR)-5-[(1R,4E)-4-[(3-fluoro-4-hydroxyphenyl)methylidene]-1-hydroxyhexyl]-4,6-bis(hydroxymethyl)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]boronic acid |
| SMILES | CC/C(=C\c1ccc(O)c(F)c1)CC[C@@H](O)C1=C(CO)C[C@H]2C(=O)N(c3cccc(B(O)O)c3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C29H33BFNO8/c1-2-16(10-17-7-8-24(35)23(31)11-17)6-9-25(36)26-18(14-33)12-21-27(22(26)15-34)29(38)32(28(21)37)20-5-3-4-19(13-20)30(39)40/h3-5,7-8,10-11,13,21-22,25,27,33-36,39-40H,2,6,9,12,14-15H2,1H3/b16-10+/t21-,22+,25-,27-/m1/s1 |
| InChIKey | FYSUUHJBDUDEMX-TVMSJZLLSA-N |
| XLogP | 1.25 |
| TPSA | 158.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|