C32H37FN2O6 — CID 135787281
(3aS,4R,7aR)-2-cyclohexyl-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-4,6-bis(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 135787281) has the molecular formula C32H37FN2O6 and a molecular weight of 564.65 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-cyclohexyl-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-4,6-bis(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-4,6-bis(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135787281 |
| Molecular Formula | C32H37FN2O6 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (3aS,4R,7aR)-2-cyclohexyl-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-4,6-bis(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@@H](CC(CO)=C([C@H](O)CC/C(=C/c3ccc(O)c(F)c3)c3ccccn3)[C@@H]2CO)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C32H37FN2O6/c33-25-15-19(9-11-27(25)38)14-20(26-8-4-5-13-34-26)10-12-28(39)29-21(17-36)16-23-30(24(29)18-37)32(41)35(31(23)40)22-6-2-1-3-7-22/h4-5,8-9,11,13-15,22-24,28,30,36-39H,1-3,6-7,10,12,16-18H2/b20-14-/t23-,24+,28-,30-/m1/s1 |
| InChIKey | JXJZEBGEULCGBY-PVFXULJWSA-N |
| XLogP | 3.84 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|