C37H42N2O5 — CID 135757656
(3aS,4R,7aR)-2-cyclohexyl-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 135757656) has the molecular formula C37H42N2O5 and a molecular weight of 594.75 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-cyclohexyl-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-cyclohexyl-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135757656 |
| Molecular Formula | C37H42N2O5 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | (3aS,4R,7aR)-2-cyclohexyl-6-ethyl-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CCC1=C([C@H](O)CC/C(=C/c2ccc(O)c3ccccc23)c2ccccn2)[C@H](CO)[C@@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C37H42N2O5/c1-2-23-21-29-35(37(44)39(36(29)43)26-10-4-3-5-11-26)30(22-40)34(23)33(42)18-16-25(31-14-8-9-19-38-31)20-24-15-17-32(41)28-13-7-6-12-27(24)28/h6-9,12-15,17,19-20,26,29-30,33,35,40-42H,2-5,10-11,16,18,21-22H2,1H3/b25-20-/t29-,30+,33-,35-/m1/s1 |
| InChIKey | ZJJAZNHOIYBBQK-KFCKSFAESA-N |
| XLogP | 6.27 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|