C38H38N2O5 — CID 135779609
(3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 135779609) has the molecular formula C38H38N2O5 and a molecular weight of 602.73 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135779609 |
| Molecular Formula | C38H38N2O5 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | (3aS,4R,7aR)-5-[(Z,1R)-1-hydroxy-5-(4-hydroxynaphthalen-1-yl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-2-phenyl-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)C1=C([C@H](O)CC/C(=C/c2ccc(O)c3ccccc23)c2ccccn2)[C@H](CO)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C38H38N2O5/c1-23(2)29-21-30-36(38(45)40(37(30)44)26-10-4-3-5-11-26)31(22-41)35(29)34(43)18-16-25(32-14-8-9-19-39-32)20-24-15-17-33(42)28-13-7-6-12-27(24)28/h3-15,17,19-20,23,30-31,34,36,41-43H,16,18,21-22H2,1-2H3/b25-20-/t30-,31+,34-,36-/m1/s1 |
| InChIKey | KFULEMZREGSDPJ-DLUCLMQTSA-N |
| XLogP | 6.39 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|