C38H37N3O5 — CID 135754816
(3aS,4R,7aR)-2-(4-anilinophenyl)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 135754816) has the molecular formula C38H37N3O5 and a molecular weight of 615.73 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-(4-anilinophenyl)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-(4-anilinophenyl)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135754816 |
| Molecular Formula | C38H37N3O5 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | (3aS,4R,7aR)-2-(4-anilinophenyl)-5-[(Z,1R)-1-hydroxy-5-(2-hydroxyphenyl)-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-6-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=C([C@H](O)CC/C(=C/c2ccccc2O)c2ccccn2)[C@H](CO)[C@@H]2C(=O)N(c3ccc(Nc4ccccc4)cc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C38H37N3O5/c1-24-21-30-36(38(46)41(37(30)45)29-17-15-28(16-18-29)40-27-10-3-2-4-11-27)31(23-42)35(24)34(44)19-14-25(32-12-7-8-20-39-32)22-26-9-5-6-13-33(26)43/h2-13,15-18,20,22,30-31,34,36,40,42-44H,14,19,21,23H2,1H3/b25-22-/t30-,31+,34-,36-/m1/s1 |
| InChIKey | NDYASKFJLTUFHN-PIJJLEKTSA-N |
| XLogP | 6.35 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|