C33H33FN2O6 — CID 135757640
(3aS,4R,7aR)-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-6-(methoxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 135757640) has the molecular formula C33H33FN2O6 and a molecular weight of 572.63 g/mol. Its IUPAC name is (3aS,4R,7aR)-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-6-(methoxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-6-(methoxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135757640 |
| Molecular Formula | C33H33FN2O6 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (3aS,4R,7aR)-5-[(Z,1R)-5-(3-fluoro-4-hydroxyphenyl)-1-hydroxy-4-pyridin-2-ylpent-4-enyl]-4-(hydroxymethyl)-6-(methoxymethyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COCC1=C([C@H](O)CC/C(=C/c2ccc(O)c(F)c2)c2ccccn2)[C@H](CO)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H33FN2O6/c1-42-19-22-17-24-31(33(41)36(32(24)40)23-7-3-2-4-8-23)25(18-37)30(22)29(39)13-11-21(27-9-5-6-14-35-27)15-20-10-12-28(38)26(34)16-20/h2-10,12,14-16,24-25,29,31,37-39H,11,13,17-19H2,1H3/b21-15-/t24-,25+,29-,31-/m1/s1 |
| InChIKey | BANZCXQNYBINCH-PTAQQWFPSA-N |
| XLogP | 4.37 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|