C36H46N2O5 — CID 23747035
(3aS,4R,7aR)-2-(1-benzylpiperidin-4-yl)-5-[(E,1R)-1-hydroxy-5-(3-hydroxyphenyl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23747035) has the molecular formula C36H46N2O5 and a molecular weight of 586.77 g/mol. Its IUPAC name is (3aS,4R,7aR)-2-(1-benzylpiperidin-4-yl)-5-[(E,1R)-1-hydroxy-5-(3-hydroxyphenyl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aR)-2-(1-benzylpiperidin-4-yl)-5-[(E,1R)-1-hydroxy-5-(3-hydroxyphenyl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23747035 |
| Molecular Formula | C36H46N2O5 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | (3aS,4R,7aR)-2-(1-benzylpiperidin-4-yl)-5-[(E,1R)-1-hydroxy-5-(3-hydroxyphenyl)-4-methylpent-4-enyl]-4-(hydroxymethyl)-6-propan-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C/C(=C\c1cccc(O)c1)CC[C@@H](O)C1=C(C(C)C)C[C@H]2C(=O)N(C3CCN(Cc4ccccc4)CC3)C(=O)[C@H]2[C@H]1CO |
| InChI | InChI=1S/C36H46N2O5/c1-23(2)29-20-30-34(31(22-39)33(29)32(41)13-12-24(3)18-26-10-7-11-28(40)19-26)36(43)38(35(30)42)27-14-16-37(17-15-27)21-25-8-5-4-6-9-25/h4-11,18-19,23,27,30-32,34,39-41H,12-17,20-22H2,1-3H3/b24-18+/t30-,31+,32-,34-/m1/s1 |
| InChIKey | GPHRSQBCIUAVOX-ONSPREGOSA-N |
| XLogP | 5.17 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|