C19H22O3 — CID 23946778
(2Z,4R,7E)-8-(4-hydroxynaphthalen-1-yl)-7-methylocta-2,7-diene-1,4-diol (PubChem CID 23946778) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2Z,4R,7E)-8-(4-hydroxynaphthalen-1-yl)-7-methylocta-2,7-diene-1,4-diol.
| Compound Name | (2Z,4R,7E)-8-(4-hydroxynaphthalen-1-yl)-7-methylocta-2,7-diene-1,4-diol |
|---|---|
| PubChem CID | 23946778 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2Z,4R,7E)-8-(4-hydroxynaphthalen-1-yl)-7-methylocta-2,7-diene-1,4-diol |
| SMILES | C/C(=C\c1ccc(O)c2ccccc12)CC[C@@H](O)/C=C\CO |
| InChI | InChI=1S/C19H22O3/c1-14(8-10-16(21)5-4-12-20)13-15-9-11-19(22)18-7-3-2-6-17(15)18/h2-7,9,11,13,16,20-22H,8,10,12H2,1H3/b5-4-,14-13+/t16-/m0/s1 |
| InChIKey | XEMYXPWAZWNFII-CWWOICMISA-N |
| XLogP | 3.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|