C17H24O4 — CID 23834663
(E,2S,3R,4R)-3-ethenyl-8-(2-hydroxyphenyl)-7-methyloct-7-ene-1,2,4-triol (PubChem CID 23834663) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is (E,2S,3R,4R)-3-ethenyl-8-(2-hydroxyphenyl)-7-methyloct-7-ene-1,2,4-triol.
| Compound Name | (E,2S,3R,4R)-3-ethenyl-8-(2-hydroxyphenyl)-7-methyloct-7-ene-1,2,4-triol |
|---|---|
| PubChem CID | 23834663 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (E,2S,3R,4R)-3-ethenyl-8-(2-hydroxyphenyl)-7-methyloct-7-ene-1,2,4-triol |
| SMILES | C=C[C@@H]([C@H](O)CO)[C@H](O)CC/C(C)=C/c1ccccc1O |
| InChI | InChI=1S/C17H24O4/c1-3-14(17(21)11-18)16(20)9-8-12(2)10-13-6-4-5-7-15(13)19/h3-7,10,14,16-21H,1,8-9,11H2,2H3/b12-10+/t14-,16-,17-/m1/s1 |
| InChIKey | QJILGANSDSYKPF-OHVBZBGNSA-N |
| XLogP | 2.09 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|