C22H28O3S — CID 23834665
(1S,2R,3R,6E)-2-ethenyl-6-[(2-hydroxyphenyl)methylidene]-1-thiophen-2-ylnonane-1,3-diol (PubChem CID 23834665) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is (1S,2R,3R,6E)-2-ethenyl-6-[(2-hydroxyphenyl)methylidene]-1-thiophen-2-ylnonane-1,3-diol.
| Compound Name | (1S,2R,3R,6E)-2-ethenyl-6-[(2-hydroxyphenyl)methylidene]-1-thiophen-2-ylnonane-1,3-diol |
|---|---|
| PubChem CID | 23834665 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (1S,2R,3R,6E)-2-ethenyl-6-[(2-hydroxyphenyl)methylidene]-1-thiophen-2-ylnonane-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccccc1O)CCC)[C@H](O)c1cccs1 |
| InChI | InChI=1S/C22H28O3S/c1-3-8-16(15-17-9-5-6-10-19(17)23)12-13-20(24)18(4-2)22(25)21-11-7-14-26-21/h4-7,9-11,14-15,18,20,22-25H,2-3,8,12-13H2,1H3/b16-15+/t18-,20-,22+/m1/s1 |
| InChIKey | RGYMJFDIWGRJHN-POXXHTGOSA-N |
| XLogP | 5.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|