C27H36O4 — CID 23747634
(1S,2R,3R,6E)-2-ethenyl-6-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1-(4-methoxyphenyl)nonane-1,3-diol (PubChem CID 23747634) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is (1S,2R,3R,6E)-2-ethenyl-6-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1-(4-methoxyphenyl)nonane-1,3-diol.
| Compound Name | (1S,2R,3R,6E)-2-ethenyl-6-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1-(4-methoxyphenyl)nonane-1,3-diol |
|---|---|
| PubChem CID | 23747634 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (1S,2R,3R,6E)-2-ethenyl-6-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1-(4-methoxyphenyl)nonane-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1cc(C)c(O)c(C)c1)CCC)[C@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H36O4/c1-6-8-20(17-21-15-18(3)26(29)19(4)16-21)9-14-25(28)24(7-2)27(30)22-10-12-23(31-5)13-11-22/h7,10-13,15-17,24-25,27-30H,2,6,8-9,14H2,1,3-5H3/b20-17+/t24-,25-,27-/m1/s1 |
| InChIKey | ORKAXYVKZMAHFV-KAGMAXICSA-N |
| XLogP | 5.88 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|