C28H30O4 — CID 23918855
(Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-1-(4-methoxyphenyl)-6-phenylhept-6-ene-1,3-diol (PubChem CID 23918855) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-1-(4-methoxyphenyl)-6-phenylhept-6-ene-1,3-diol.
| Compound Name | (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-1-(4-methoxyphenyl)-6-phenylhept-6-ene-1,3-diol |
|---|---|
| PubChem CID | 23918855 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-1-(4-methoxyphenyl)-6-phenylhept-6-ene-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccccc1O)c1ccccc1)[C@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H30O4/c1-3-25(28(31)21-13-16-24(32-2)17-14-21)27(30)18-15-22(20-9-5-4-6-10-20)19-23-11-7-8-12-26(23)29/h3-14,16-17,19,25,27-31H,1,15,18H2,2H3/b22-19-/t25-,27-,28-/m1/s1 |
| InChIKey | PQZQGLZJGYRWJT-VXEYLNKESA-N |
| XLogP | 5.62 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|