C23H30O4 — CID 23918860
(Z,3R,4R,5R)-4-ethenyl-9-[5-(hydroxymethyl)furan-2-yl]-2-methyl-8-phenylnon-8-ene-3,5-diol (PubChem CID 23918860) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (Z,3R,4R,5R)-4-ethenyl-9-[5-(hydroxymethyl)furan-2-yl]-2-methyl-8-phenylnon-8-ene-3,5-diol.
| Compound Name | (Z,3R,4R,5R)-4-ethenyl-9-[5-(hydroxymethyl)furan-2-yl]-2-methyl-8-phenylnon-8-ene-3,5-diol |
|---|---|
| PubChem CID | 23918860 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (Z,3R,4R,5R)-4-ethenyl-9-[5-(hydroxymethyl)furan-2-yl]-2-methyl-8-phenylnon-8-ene-3,5-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccc(CO)o1)c1ccccc1)[C@H](O)C(C)C |
| InChI | InChI=1S/C23H30O4/c1-4-21(23(26)16(2)3)22(25)13-10-18(17-8-6-5-7-9-17)14-19-11-12-20(15-24)27-19/h4-9,11-12,14,16,21-26H,1,10,13,15H2,2-3H3/b18-14-/t21-,22-,23-/m1/s1 |
| InChIKey | KXAIUTWEESHINS-ZHJYJJPYSA-N |
| XLogP | 4.27 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|