C19H28O3 — CID 23834664
(2R,3S,4R,7E)-3-ethenyl-7-[(2-hydroxyphenyl)methylidene]decane-2,4-diol (PubChem CID 23834664) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2R,3S,4R,7E)-3-ethenyl-7-[(2-hydroxyphenyl)methylidene]decane-2,4-diol.
| Compound Name | (2R,3S,4R,7E)-3-ethenyl-7-[(2-hydroxyphenyl)methylidene]decane-2,4-diol |
|---|---|
| PubChem CID | 23834664 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2R,3S,4R,7E)-3-ethenyl-7-[(2-hydroxyphenyl)methylidene]decane-2,4-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccccc1O)CCC)[C@@H](C)O |
| InChI | InChI=1S/C19H28O3/c1-4-8-15(13-16-9-6-7-10-18(16)21)11-12-19(22)17(5-2)14(3)20/h5-7,9-10,13-14,17,19-22H,2,4,8,11-12H2,1,3H3/b15-13+/t14-,17+,19-/m1/s1 |
| InChIKey | MINRYIKGBIZHHX-GHFNFZOGSA-N |
| XLogP | 3.90 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|