C28H32O3 — CID 23776822
(1S,2R,3R,6E)-2-ethenyl-6-[(4-hydroxynaphthalen-1-yl)methylidene]-1-phenylnonane-1,3-diol (PubChem CID 23776822) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is (1S,2R,3R,6E)-2-ethenyl-6-[(4-hydroxynaphthalen-1-yl)methylidene]-1-phenylnonane-1,3-diol.
| Compound Name | (1S,2R,3R,6E)-2-ethenyl-6-[(4-hydroxynaphthalen-1-yl)methylidene]-1-phenylnonane-1,3-diol |
|---|---|
| PubChem CID | 23776822 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (1S,2R,3R,6E)-2-ethenyl-6-[(4-hydroxynaphthalen-1-yl)methylidene]-1-phenylnonane-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccc(O)c2ccccc12)CCC)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C28H32O3/c1-3-10-20(19-22-16-18-27(30)25-14-9-8-13-24(22)25)15-17-26(29)23(4-2)28(31)21-11-6-5-7-12-21/h4-9,11-14,16,18-19,23,26,28-31H,2-3,10,15,17H2,1H3/b20-19+/t23-,26-,28-/m1/s1 |
| InChIKey | JIZOKYLONYZQMK-SAZITMRUSA-N |
| XLogP | 6.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|