C20H28O5 — CID 23890818
ethyl (2S,3R,4R,7E)-3-ethenyl-2,4-dihydroxy-7-[(2-hydroxyphenyl)methylidene]nonanoate (PubChem CID 23890818) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is ethyl (2S,3R,4R,7E)-3-ethenyl-2,4-dihydroxy-7-[(2-hydroxyphenyl)methylidene]nonanoate.
| Compound Name | ethyl (2S,3R,4R,7E)-3-ethenyl-2,4-dihydroxy-7-[(2-hydroxyphenyl)methylidene]nonanoate |
|---|---|
| PubChem CID | 23890818 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | ethyl (2S,3R,4R,7E)-3-ethenyl-2,4-dihydroxy-7-[(2-hydroxyphenyl)methylidene]nonanoate |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccccc1O)CC)[C@H](O)C(=O)OCC |
| InChI | InChI=1S/C20H28O5/c1-4-14(13-15-9-7-8-10-17(15)21)11-12-18(22)16(5-2)19(23)20(24)25-6-3/h5,7-10,13,16,18-19,21-23H,2,4,6,11-12H2,1,3H3/b14-13+/t16-,18-,19+/m1/s1 |
| InChIKey | MQJYTVDODYCOGZ-MRUVVIFOSA-N |
| XLogP | 3.05 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|