C23H26ClNO5 — CID 135846898
ethyl (Z,2S,3R,4R)-8-(2-chloro-4-hydroxyphenyl)-3-ethenyl-2,4-dihydroxy-7-pyridin-2-yloct-7-enoate (PubChem CID 135846898) has the molecular formula C23H26ClNO5 and a molecular weight of 431.92 g/mol. Its IUPAC name is ethyl (Z,2S,3R,4R)-8-(2-chloro-4-hydroxyphenyl)-3-ethenyl-2,4-dihydroxy-7-pyridin-2-yloct-7-enoate.
| Compound Name | ethyl (Z,2S,3R,4R)-8-(2-chloro-4-hydroxyphenyl)-3-ethenyl-2,4-dihydroxy-7-pyridin-2-yloct-7-enoate |
|---|---|
| PubChem CID | 135846898 |
| Molecular Formula | C23H26ClNO5 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl (Z,2S,3R,4R)-8-(2-chloro-4-hydroxyphenyl)-3-ethenyl-2,4-dihydroxy-7-pyridin-2-yloct-7-enoate |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccc(O)cc1Cl)c1ccccn1)[C@H](O)C(=O)OCC |
| InChI | InChI=1S/C23H26ClNO5/c1-3-18(22(28)23(29)30-4-2)21(27)11-9-16(20-7-5-6-12-25-20)13-15-8-10-17(26)14-19(15)24/h3,5-8,10,12-14,18,21-22,26-28H,1,4,9,11H2,2H3/b16-13-/t18-,21-,22+/m1/s1 |
| InChIKey | QWYGUKHALURKOI-LDXBEPGSSA-N |
| XLogP | 3.85 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|