C24H27BClNO3 — CID 135754738
3-chloro-4-[(Z)-4-(2-hydroxy-5-pent-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]phenol (PubChem CID 135754738) has the molecular formula C24H27BClNO3 and a molecular weight of 423.75 g/mol. Its IUPAC name is 3-chloro-4-[(Z)-4-(2-hydroxy-5-pent-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]phenol.
| Compound Name | 3-chloro-4-[(Z)-4-(2-hydroxy-5-pent-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 135754738 |
| Molecular Formula | C24H27BClNO3 |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-chloro-4-[(Z)-4-(2-hydroxy-5-pent-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]phenol |
| SMILES | C=C(CCC)C1=CCB(O)OC1CC/C(=C/c1ccc(O)cc1Cl)c1ccccn1 |
| InChI | InChI=1S/C24H27BClNO3/c1-3-6-17(2)21-12-13-25(29)30-24(21)11-9-19(23-7-4-5-14-27-23)15-18-8-10-20(28)16-22(18)26/h4-5,7-8,10,12,14-16,24,28-29H,2-3,6,9,11,13H2,1H3/b19-15- |
| InChIKey | DJKYACMYXGSAPA-CYVLTUHYSA-N |
| XLogP | 5.92 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|