C29H29BO4 — CID 23861969
4-[(Z)-4-[2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinin-6-yl]-2-phenylbut-1-enyl]phenol (PubChem CID 23861969) has the molecular formula C29H29BO4 and a molecular weight of 452.36 g/mol. Its IUPAC name is 4-[(Z)-4-[2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinin-6-yl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 4-[(Z)-4-[2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinin-6-yl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23861969 |
| Molecular Formula | C29H29BO4 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 4-[(Z)-4-[2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinin-6-yl]-2-phenylbut-1-enyl]phenol |
| SMILES | C=C(COc1ccccc1)C1=CCB(O)OC1CC/C(=C/c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H29BO4/c1-22(21-33-27-10-6-3-7-11-27)28-18-19-30(32)34-29(28)17-14-25(24-8-4-2-5-9-24)20-23-12-15-26(31)16-13-23/h2-13,15-16,18,20,29,31-32H,1,14,17,19,21H2/b25-20- |
| InChIKey | QXAJDIGTRXXIHP-QQTULTPQSA-N |
| XLogP | 6.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|