C25H28BFO3 — CID 23973792
2-fluoro-4-[(Z)-4-(2-hydroxy-5-pent-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-phenylbut-1-enyl]phenol (PubChem CID 23973792) has the molecular formula C25H28BFO3 and a molecular weight of 406.31 g/mol. Its IUPAC name is 2-fluoro-4-[(Z)-4-(2-hydroxy-5-pent-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-phenylbut-1-enyl]phenol.
| Compound Name | 2-fluoro-4-[(Z)-4-(2-hydroxy-5-pent-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23973792 |
| Molecular Formula | C25H28BFO3 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2-fluoro-4-[(Z)-4-(2-hydroxy-5-pent-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-phenylbut-1-enyl]phenol |
| SMILES | C=C(CCC)C1=CCB(O)OC1CC/C(=C/c1ccc(O)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C25H28BFO3/c1-3-7-18(2)22-14-15-26(29)30-25(22)13-11-21(20-8-5-4-6-9-20)16-19-10-12-24(28)23(27)17-19/h4-6,8-10,12,14,16-17,25,28-29H,2-3,7,11,13,15H2,1H3/b21-16- |
| InChIKey | GXCRGHLVLUUVER-PGMHBOJBSA-N |
| XLogP | 6.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|