C18H23BO3 — CID 23889772
2-[(E)-4-(2-hydroxy-5-prop-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-methylbut-1-enyl]phenol (PubChem CID 23889772) has the molecular formula C18H23BO3 and a molecular weight of 298.19 g/mol. Its IUPAC name is 2-[(E)-4-(2-hydroxy-5-prop-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-methylbut-1-enyl]phenol.
| Compound Name | 2-[(E)-4-(2-hydroxy-5-prop-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-methylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23889772 |
| Molecular Formula | C18H23BO3 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-[(E)-4-(2-hydroxy-5-prop-1-en-2-yl-3,6-dihydrooxaborinin-6-yl)-2-methylbut-1-enyl]phenol |
| SMILES | C=C(C)C1=CCB(O)OC1CC/C(C)=C/c1ccccc1O |
| InChI | InChI=1S/C18H23BO3/c1-13(2)16-10-11-19(21)22-18(16)9-8-14(3)12-15-6-4-5-7-17(15)20/h4-7,10,12,18,20-21H,1,8-9,11H2,2-3H3/b14-12+ |
| InChIKey | KMXIVRLWZPQIMM-WYMLVPIESA-N |
| XLogP | 3.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|