C23H26BNO3 — CID 135569220
4-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]phenol (PubChem CID 135569220) has the molecular formula C23H26BNO3 and a molecular weight of 375.28 g/mol. Its IUPAC name is 4-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]phenol.
| Compound Name | 4-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 135569220 |
| Molecular Formula | C23H26BNO3 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 4-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]phenol |
| SMILES | C=C(CC)C1=CCB(O)OC1CC/C(=C/c1ccc(O)cc1)c1ccccn1 |
| InChI | InChI=1S/C23H26BNO3/c1-3-17(2)21-13-14-24(27)28-23(21)12-9-19(22-6-4-5-15-25-22)16-18-7-10-20(26)11-8-18/h4-8,10-11,13,15-16,23,26-27H,2-3,9,12,14H2,1H3/b19-16- |
| InChIKey | RWIKCGGUSZFRMH-MNDPQUGUSA-N |
| XLogP | 4.88 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|