C27H28BNO3 — CID 135754741
4-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]naphthalen-1-ol (PubChem CID 135754741) has the molecular formula C27H28BNO3 and a molecular weight of 425.34 g/mol. Its IUPAC name is 4-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]naphthalen-1-ol.
| Compound Name | 4-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 135754741 |
| Molecular Formula | C27H28BNO3 |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 4-[(Z)-4-(5-but-1-en-2-yl-2-hydroxy-3,6-dihydrooxaborinin-6-yl)-2-pyridin-2-ylbut-1-enyl]naphthalen-1-ol |
| SMILES | C=C(CC)C1=CCB(O)OC1CC/C(=C/c1ccc(O)c2ccccc12)c1ccccn1 |
| InChI | InChI=1S/C27H28BNO3/c1-3-19(2)22-15-16-28(31)32-27(22)14-12-21(25-10-6-7-17-29-25)18-20-11-13-26(30)24-9-5-4-8-23(20)24/h4-11,13,15,17-18,27,30-31H,2-3,12,14,16H2,1H3/b21-18- |
| InChIKey | FBILWYWAGFFHHH-UZYVYHOESA-N |
| XLogP | 6.03 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|