C28H30BNO5S — CID 135757563
4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]naphthalen-1-ol (PubChem CID 135757563) has the molecular formula C28H30BNO5S and a molecular weight of 503.43 g/mol. Its IUPAC name is 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]naphthalen-1-ol.
| Compound Name | 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 135757563 |
| Molecular Formula | C28H30BNO5S |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]naphthalen-1-ol |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3ccc(O)c4ccccc34)c3ccccn3)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C28H30BNO5S/c1-2-7-21-18-36(33,34)27-17-29(32)35-26(28(21)27)14-12-20(24-10-5-6-15-30-24)16-19-11-13-25(31)23-9-4-3-8-22(19)23/h3-6,8-11,13,15-16,26-27,31-32H,2,7,12,14,17-18H2,1H3/b20-16-/t26-,27+/m1/s1 |
| InChIKey | DBOJANLSLOKFIT-XTKPGYGBSA-N |
| XLogP | 5.03 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|