C23H25BFNO5S — CID 135775479
4-[(Z)-4-[(4R,7aS)-3-ethyl-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]-2-fluorophenol (PubChem CID 135775479) has the molecular formula C23H25BFNO5S and a molecular weight of 457.33 g/mol. Its IUPAC name is 4-[(Z)-4-[(4R,7aS)-3-ethyl-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]-2-fluorophenol.
| Compound Name | 4-[(Z)-4-[(4R,7aS)-3-ethyl-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]-2-fluorophenol |
|---|---|
| PubChem CID | 135775479 |
| Molecular Formula | C23H25BFNO5S |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4-[(Z)-4-[(4R,7aS)-3-ethyl-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-pyridin-2-ylbut-1-enyl]-2-fluorophenol |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccc(O)c(F)c3)c3ccccn3)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H25BFNO5S/c1-2-16-14-32(29,30)22-13-24(28)31-21(23(16)22)9-7-17(19-5-3-4-10-26-19)11-15-6-8-20(27)18(25)12-15/h3-6,8,10-12,21-22,27-28H,2,7,9,13-14H2,1H3/b17-11-/t21-,22+/m1/s1 |
| InChIKey | QOLBDOZTFPUPJC-IYSVRMAJSA-N |
| XLogP | 3.63 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|