C24H26BFO5S — CID 23804867
4-[(Z)-4-[(4R,7aS)-3-ethyl-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-fluorophenol (PubChem CID 23804867) has the molecular formula C24H26BFO5S and a molecular weight of 456.34 g/mol. Its IUPAC name is 4-[(Z)-4-[(4R,7aS)-3-ethyl-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-fluorophenol.
| Compound Name | 4-[(Z)-4-[(4R,7aS)-3-ethyl-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-fluorophenol |
|---|---|
| PubChem CID | 23804867 |
| Molecular Formula | C24H26BFO5S |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 4-[(Z)-4-[(4R,7aS)-3-ethyl-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2-fluorophenol |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccc(O)c(F)c3)c3ccccc3)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C24H26BFO5S/c1-2-17-15-32(29,30)23-14-25(28)31-22(24(17)23)11-9-19(18-6-4-3-5-7-18)12-16-8-10-21(27)20(26)13-16/h3-8,10,12-13,22-23,27-28H,2,9,11,14-15H2,1H3/b19-12-/t22-,23+/m1/s1 |
| InChIKey | BTHJEIJNUXDTAN-FIZWJUEBSA-N |
| XLogP | 4.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|