C27H33BO5S — CID 23862063
4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2,6-dimethylphenol (PubChem CID 23862063) has the molecular formula C27H33BO5S and a molecular weight of 480.44 g/mol. Its IUPAC name is 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2,6-dimethylphenol.
| Compound Name | 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 23862063 |
| Molecular Formula | C27H33BO5S |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 4-[(Z)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]-2,6-dimethylphenol |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3cc(C)c(O)c(C)c3)c3ccccc3)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C27H33BO5S/c1-4-8-23-17-34(31,32)25-16-28(30)33-24(26(23)25)12-11-22(21-9-6-5-7-10-21)15-20-13-18(2)27(29)19(3)14-20/h5-7,9-10,13-15,24-25,29-30H,4,8,11-12,16-17H2,1-3H3/b22-15-/t24-,25+/m1/s1 |
| InChIKey | NNJFVZLCFAVWCH-JTELXJHWSA-N |
| XLogP | 5.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|