C23H24FNO5S — CID 135757571
4-[(Z)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]-2-fluorophenol (PubChem CID 135757571) has the molecular formula C23H24FNO5S and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-[(Z)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]-2-fluorophenol.
| Compound Name | 4-[(Z)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]-2-fluorophenol |
|---|---|
| PubChem CID | 135757571 |
| Molecular Formula | C23H24FNO5S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 4-[(Z)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]-2-fluorophenol |
| SMILES | COCC1=C2[C@@H](CC/C(=C/c3ccc(O)c(F)c3)c3ccccn3)OC[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H24FNO5S/c1-29-12-17-14-31(27,28)22-13-30-21(23(17)22)8-6-16(19-4-2-3-9-25-19)10-15-5-7-20(26)18(24)11-15/h2-5,7,9-11,21-22,26H,6,8,12-14H2,1H3/b16-10-/t21-,22+/m1/s1 |
| InChIKey | CXMNXNIVBJKSKM-OGDAUGASSA-N |
| XLogP | 3.39 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|