C23H25NO4S — CID 135846769
4-[(Z)-4-[(4R,6aR)-3-ethyl-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]phenol (PubChem CID 135846769) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is 4-[(Z)-4-[(4R,6aR)-3-ethyl-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]phenol.
| Compound Name | 4-[(Z)-4-[(4R,6aR)-3-ethyl-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 135846769 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[(Z)-4-[(4R,6aR)-3-ethyl-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]phenol |
| SMILES | CCC1=C2[C@@H](CC/C(=C/c3ccc(O)cc3)c3ccccn3)OC[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H25NO4S/c1-2-17-15-29(26,27)22-14-28-21(23(17)22)11-8-18(20-5-3-4-12-24-20)13-16-6-9-19(25)10-7-16/h3-7,9-10,12-13,21-22,25H,2,8,11,14-15H2,1H3/b18-13-/t21-,22+/m1/s1 |
| InChIKey | BUKJQDPXBRAHEF-QBZDTREQSA-N |
| XLogP | 4.01 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|