C23H27NO5S — CID 23746698
[5-[(Z)-4-[(4R,6aR)-1,1-dioxo-3-propyl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]furan-2-yl]methanol (PubChem CID 23746698) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is [5-[(Z)-4-[(4R,6aR)-1,1-dioxo-3-propyl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]furan-2-yl]methanol.
| Compound Name | [5-[(Z)-4-[(4R,6aR)-1,1-dioxo-3-propyl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 23746698 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [5-[(Z)-4-[(4R,6aR)-1,1-dioxo-3-propyl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-pyridin-2-ylbut-1-enyl]furan-2-yl]methanol |
| SMILES | CCCC1=C2[C@@H](CC/C(=C/c3ccc(CO)o3)c3ccccn3)OC[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H27NO5S/c1-2-5-17-15-30(26,27)22-14-28-21(23(17)22)10-7-16(20-6-3-4-11-24-20)12-18-8-9-19(13-25)29-18/h3-4,6,8-9,11-12,21-22,25H,2,5,7,10,13-15H2,1H3/b16-12-/t21-,22+/m1/s1 |
| InChIKey | SJESRLKDGIKCOY-UUOUJJQOSA-N |
| XLogP | 3.78 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|