C19H27BO6S — CID 23862059
[5-[(E)-2-[2-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]furan-2-yl]methanol (PubChem CID 23862059) has the molecular formula C19H27BO6S and a molecular weight of 394.30 g/mol. Its IUPAC name is [5-[(E)-2-[2-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]furan-2-yl]methanol.
| Compound Name | [5-[(E)-2-[2-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 23862059 |
| Molecular Formula | C19H27BO6S |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [5-[(E)-2-[2-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]furan-2-yl]methanol |
| SMILES | CCC/C(=C\c1ccc(CO)o1)CC[C@H]1OB(O)C[C@H]2C1=C(C)CS2(=O)=O |
| InChI | InChI=1S/C19H27BO6S/c1-3-4-14(9-15-6-7-16(11-21)25-15)5-8-17-19-13(2)12-27(23,24)18(19)10-20(22)26-17/h6-7,9,17-18,21-22H,3-5,8,10-12H2,1-2H3/b14-9+/t17-,18+/m1/s1 |
| InChIKey | NVSGIKVMXATITI-OZNDBLHSSA-N |
| XLogP | 2.73 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|