C21H28BIO7S — CID 23746660
4-[(E)-2-[2-[(4R,7aS)-6-hydroxy-3-(hydroxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]-2-iodo-6-methoxyphenol (PubChem CID 23746660) has the molecular formula C21H28BIO7S and a molecular weight of 562.23 g/mol. Its IUPAC name is 4-[(E)-2-[2-[(4R,7aS)-6-hydroxy-3-(hydroxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(E)-2-[2-[(4R,7aS)-6-hydroxy-3-(hydroxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 23746660 |
| Molecular Formula | C21H28BIO7S |
| Molecular Weight | 562.23 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | 4-[(E)-2-[2-[(4R,7aS)-6-hydroxy-3-(hydroxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]ethyl]pent-1-enyl]-2-iodo-6-methoxyphenol |
| SMILES | CCC/C(=C\c1cc(I)c(O)c(OC)c1)CC[C@H]1OB(O)C[C@H]2C1=C(CO)CS2(=O)=O |
| InChI | InChI=1S/C21H28BIO7S/c1-3-4-13(7-14-8-16(23)21(25)18(9-14)29-2)5-6-17-20-15(11-24)12-31(27,28)19(20)10-22(26)30-17/h7-9,17,19,24-26H,3-6,10-12H2,1-2H3/b13-7+/t17-,19+/m1/s1 |
| InChIKey | YKGNJHKEFSHMNA-INDQBGCHSA-N |
| XLogP | 2.93 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|