C21H28O5S — CID 23804913
4-[(E)-2-[2-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]phenol (PubChem CID 23804913) has the molecular formula C21H28O5S and a molecular weight of 392.52 g/mol. Its IUPAC name is 4-[(E)-2-[2-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]phenol.
| Compound Name | 4-[(E)-2-[2-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]phenol |
|---|---|
| PubChem CID | 23804913 |
| Molecular Formula | C21H28O5S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[(E)-2-[2-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]phenol |
| SMILES | CCC/C(=C\c1ccc(O)cc1)CC[C@H]1OC[C@H]2C1=C(COC)CS2(=O)=O |
| InChI | InChI=1S/C21H28O5S/c1-3-4-15(11-16-5-8-18(22)9-6-16)7-10-19-21-17(12-25-2)14-27(23,24)20(21)13-26-19/h5-6,8-9,11,19-20,22H,3-4,7,10,12-14H2,1-2H3/b15-11+/t19-,20+/m1/s1 |
| InChIKey | QFPSDVXNVISWTF-NPVFBEAJSA-N |
| XLogP | 3.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|