C19H24O5S — CID 23973891
3-[(E)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]phenol (PubChem CID 23973891) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is 3-[(E)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]phenol.
| Compound Name | 3-[(E)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23973891 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-[(E)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]phenol |
| SMILES | COCC1=C2[C@@H](CC/C(C)=C/c3cccc(O)c3)OC[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C19H24O5S/c1-13(8-14-4-3-5-16(20)9-14)6-7-17-19-15(10-23-2)12-25(21,22)18(19)11-24-17/h3-5,8-9,17-18,20H,6-7,10-12H2,1-2H3/b13-8+/t17-,18+/m1/s1 |
| InChIKey | GULAMOLERCDCKU-SUHLXZCWSA-N |
| XLogP | 2.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|