C26H29BrO5S — CID 23833734
2-[(E)-2-[2-[(4R,6aR)-1,1-dioxo-3-(phenoxymethyl)-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]-4-bromophenol (PubChem CID 23833734) has the molecular formula C26H29BrO5S and a molecular weight of 533.48 g/mol. Its IUPAC name is 2-[(E)-2-[2-[(4R,6aR)-1,1-dioxo-3-(phenoxymethyl)-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]-4-bromophenol.
| Compound Name | 2-[(E)-2-[2-[(4R,6aR)-1,1-dioxo-3-(phenoxymethyl)-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]-4-bromophenol |
|---|---|
| PubChem CID | 23833734 |
| Molecular Formula | C26H29BrO5S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 2-[(E)-2-[2-[(4R,6aR)-1,1-dioxo-3-(phenoxymethyl)-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]-4-bromophenol |
| SMILES | CCC/C(=C\c1cc(Br)ccc1O)CC[C@H]1OC[C@H]2C1=C(COc1ccccc1)CS2(=O)=O |
| InChI | InChI=1S/C26H29BrO5S/c1-2-6-18(13-19-14-21(27)10-11-23(19)28)9-12-24-26-20(15-31-22-7-4-3-5-8-22)17-33(29,30)25(26)16-32-24/h3-5,7-8,10-11,13-14,24-25,28H,2,6,9,12,15-17H2,1H3/b18-13+/t24-,25+/m1/s1 |
| InChIKey | QOPGEHZBPDABBW-DTQNOHPWSA-N |
| XLogP | 5.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|