C38H48O5SSi — CID 23746702
4-[(E)-2-[2-[(4R,6aR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]-2,6-dimethylphenol (PubChem CID 23746702) has the molecular formula C38H48O5SSi and a molecular weight of 644.95 g/mol. Its IUPAC name is 4-[(E)-2-[2-[(4R,6aR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]-2,6-dimethylphenol.
| Compound Name | 4-[(E)-2-[2-[(4R,6aR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 23746702 |
| Molecular Formula | C38H48O5SSi |
| Molecular Weight | 644.95 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | 4-[(E)-2-[2-[(4R,6aR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]ethyl]pent-1-enyl]-2,6-dimethylphenol |
| SMILES | CCC/C(=C\c1cc(C)c(O)c(C)c1)CC[C@H]1OC[C@H]2C1=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CS2(=O)=O |
| InChI | InChI=1S/C38H48O5SSi/c1-7-14-29(23-30-21-27(2)37(39)28(3)22-30)19-20-34-36-31(26-44(40,41)35(36)25-42-34)24-43-45(38(4,5)6,32-15-10-8-11-16-32)33-17-12-9-13-18-33/h8-13,15-18,21-23,34-35,39H,7,14,19-20,24-26H2,1-6H3/b29-23+/t34-,35+/m1/s1 |
| InChIKey | SAUUFUTUFFTUAK-MCJDGYMKSA-N |
| XLogP | 7.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.95 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|