C38H43BO7SSi — CID 23833667
[5-[(Z)-4-[(4R,7aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]furan-2-yl]methanol (PubChem CID 23833667) has the molecular formula C38H43BO7SSi and a molecular weight of 682.72 g/mol. Its IUPAC name is [5-[(Z)-4-[(4R,7aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]furan-2-yl]methanol.
| Compound Name | [5-[(Z)-4-[(4R,7aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 23833667 |
| Molecular Formula | C38H43BO7SSi |
| Molecular Weight | 682.72 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | [5-[(Z)-4-[(4R,7aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-hydroxy-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]furan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](OCC1=C2[C@@H](CC/C(=C/c3ccc(CO)o3)c3ccccc3)OB(O)C[C@@H]2S(=O)(=O)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H43BO7SSi/c1-38(2,3)48(33-15-9-5-10-16-33,34-17-11-6-12-18-34)44-26-30-27-47(42,43)36-24-39(41)46-35(37(30)36)22-19-29(28-13-7-4-8-14-28)23-31-20-21-32(25-40)45-31/h4-18,20-21,23,35-36,40-41H,19,22,24-27H2,1-3H3/b29-23-/t35-,36+/m1/s1 |
| InChIKey | KIZGQMHDKVMLQY-SKBCWIAYSA-N |
| XLogP | 5.64 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|