C23H27BO6S — CID 23973857
4-[(E)-4-[(4R,7aS)-6-hydroxy-3-(methoxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]naphthalen-1-ol (PubChem CID 23973857) has the molecular formula C23H27BO6S and a molecular weight of 442.34 g/mol. Its IUPAC name is 4-[(E)-4-[(4R,7aS)-6-hydroxy-3-(methoxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]naphthalen-1-ol.
| Compound Name | 4-[(E)-4-[(4R,7aS)-6-hydroxy-3-(methoxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 23973857 |
| Molecular Formula | C23H27BO6S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[(E)-4-[(4R,7aS)-6-hydroxy-3-(methoxymethyl)-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]naphthalen-1-ol |
| SMILES | COCC1=C2[C@@H](CC/C(C)=C/c3ccc(O)c4ccccc34)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H27BO6S/c1-15(11-16-8-9-20(25)19-6-4-3-5-18(16)19)7-10-21-23-17(13-29-2)14-31(27,28)22(23)12-24(26)30-21/h3-6,8-9,11,21-22,25-26H,7,10,12-14H2,1-2H3/b15-11+/t21-,22+/m1/s1 |
| InChIKey | GTZYUXNZYFIVAZ-SBBLWSMMSA-N |
| XLogP | 3.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|