C20H26BBrO5S — CID 23804868
2-[(E)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]-4-bromophenol (PubChem CID 23804868) has the molecular formula C20H26BBrO5S and a molecular weight of 469.21 g/mol. Its IUPAC name is 2-[(E)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]-4-bromophenol.
| Compound Name | 2-[(E)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]-4-bromophenol |
|---|---|
| PubChem CID | 23804868 |
| Molecular Formula | C20H26BBrO5S |
| Molecular Weight | 469.21 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-[(E)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-propyl-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]-4-bromophenol |
| SMILES | CCCC1=C2[C@@H](CC/C(C)=C/c3cc(Br)ccc3O)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C20H26BBrO5S/c1-3-4-14-12-28(25,26)19-11-21(24)27-18(20(14)19)8-5-13(2)9-15-10-16(22)6-7-17(15)23/h6-7,9-10,18-19,23-24H,3-5,8,11-12H2,1-2H3/b13-9+/t18-,19+/m1/s1 |
| InChIKey | RMNUILDNGFSCKY-AMVALYDKSA-N |
| XLogP | 4.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|