C20H26O4S — CID 23833710
4-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propyl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]phenol (PubChem CID 23833710) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is 4-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propyl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]phenol.
| Compound Name | 4-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propyl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23833710 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propyl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]phenol |
| SMILES | CCCC1=C2[C@@H](CC/C(C)=C/c3ccc(O)cc3)OC[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C20H26O4S/c1-3-4-16-13-25(22,23)19-12-24-18(20(16)19)10-5-14(2)11-15-6-8-17(21)9-7-15/h6-9,11,18-19,21H,3-5,10,12-13H2,1-2H3/b14-11+/t18-,19+/m1/s1 |
| InChIKey | ZMAYFXMAZXIUQS-YYYKYCEESA-N |
| XLogP | 3.87 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|