C19H23BrO5S — CID 23833733
2-[(E)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]-4-bromophenol (PubChem CID 23833733) has the molecular formula C19H23BrO5S and a molecular weight of 443.36 g/mol. Its IUPAC name is 2-[(E)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]-4-bromophenol.
| Compound Name | 2-[(E)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]-4-bromophenol |
|---|---|
| PubChem CID | 23833733 |
| Molecular Formula | C19H23BrO5S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[(E)-4-[(4R,6aR)-3-(methoxymethyl)-1,1-dioxo-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-methylbut-1-enyl]-4-bromophenol |
| SMILES | COCC1=C2[C@@H](CC/C(C)=C/c3cc(Br)ccc3O)OC[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C19H23BrO5S/c1-12(7-13-8-15(20)4-5-16(13)21)3-6-17-19-14(9-24-2)11-26(22,23)18(19)10-25-17/h4-5,7-8,17-18,21H,3,6,9-11H2,1-2H3/b12-7+/t17-,18+/m1/s1 |
| InChIKey | XFZAJJWICOQBAX-JVGUAYRASA-N |
| XLogP | 3.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|