C25H28BIO7S — CID 23945778
4-[(E)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-(phenoxymethyl)-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]-2-iodo-6-methoxyphenol (PubChem CID 23945778) has the molecular formula C25H28BIO7S and a molecular weight of 610.28 g/mol. Its IUPAC name is 4-[(E)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-(phenoxymethyl)-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(E)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-(phenoxymethyl)-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 23945778 |
| Molecular Formula | C25H28BIO7S |
| Molecular Weight | 610.28 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | 4-[(E)-4-[(4R,7aS)-6-hydroxy-1,1-dioxo-3-(phenoxymethyl)-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-methylbut-1-enyl]-2-iodo-6-methoxyphenol |
| SMILES | COc1cc(/C=C(\C)CC[C@H]2OB(O)C[C@H]3C2=C(COc2ccccc2)CS3(=O)=O)cc(I)c1O |
| InChI | InChI=1S/C25H28BIO7S/c1-16(10-17-11-20(27)25(28)22(12-17)32-2)8-9-21-24-18(14-33-19-6-4-3-5-7-19)15-35(30,31)23(24)13-26(29)34-21/h3-7,10-12,21,23,28-29H,8-9,13-15H2,1-2H3/b16-10+/t21-,23+/m1/s1 |
| InChIKey | DUXNLOFPMCDNQQ-BEAGGLFUSA-N |
| XLogP | 4.24 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|